C18H18Cl3NO2 — CID 173162232
2-chloro-N-[2-(3,4-dichlorophenyl)-2-hydroxybutyl]-N-phenylacetamide (PubChem CID 173162232) has the molecular formula C18H18Cl3NO2 and a molecular weight of 386.71 g/mol. Its IUPAC name is 2-chloro-N-[2-(3,4-dichlorophenyl)-2-hydroxybutyl]-N-phenylacetamide.
| Compound Name | 2-chloro-N-[2-(3,4-dichlorophenyl)-2-hydroxybutyl]-N-phenylacetamide |
|---|---|
| PubChem CID | 173162232 |
| Molecular Formula | C18H18Cl3NO2 |
| Molecular Weight | 386.71 g/mol |
| Exact Mass | 385.04 |
| IUPAC Name | 2-chloro-N-[2-(3,4-dichlorophenyl)-2-hydroxybutyl]-N-phenylacetamide |
| SMILES | CCC(O)(CN(C(=O)CCl)c1ccccc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H18Cl3NO2/c1-2-18(24,13-8-9-15(20)16(21)10-13)12-22(17(23)11-19)14-6-4-3-5-7-14/h3-10,24H,2,11-12H2,1H3 |
| InChIKey | XKUJNZLMAMOZTA-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.71 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|