C18H16Cl3F2NO2 — CID 173162270
2-chloro-N-[2-(3,4-dichlorophenyl)-2-hydroxybutyl]-N-(3,4-difluorophenyl)acetamide (PubChem CID 173162270) has the molecular formula C18H16Cl3F2NO2 and a molecular weight of 422.69 g/mol. Its IUPAC name is 2-chloro-N-[2-(3,4-dichlorophenyl)-2-hydroxybutyl]-N-(3,4-difluorophenyl)acetamide.
| Compound Name | 2-chloro-N-[2-(3,4-dichlorophenyl)-2-hydroxybutyl]-N-(3,4-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 173162270 |
| Molecular Formula | C18H16Cl3F2NO2 |
| Molecular Weight | 422.69 g/mol |
| Exact Mass | 421.02 |
| IUPAC Name | 2-chloro-N-[2-(3,4-dichlorophenyl)-2-hydroxybutyl]-N-(3,4-difluorophenyl)acetamide |
| SMILES | CCC(O)(CN(C(=O)CCl)c1ccc(F)c(F)c1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H16Cl3F2NO2/c1-2-18(26,11-3-5-13(20)14(21)7-11)10-24(17(25)9-19)12-4-6-15(22)16(23)8-12/h3-8,26H,2,9-10H2,1H3 |
| InChIKey | IZSXRMKNYSHFKU-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.69 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|