About N-ethyl-1-[methyl(triphenyl)-λ5-phosphanyl]formamide;hydrobromide
N-ethyl-1-[methyl(triphenyl)-λ5-phosphanyl]formamide;hydrobromide (PubChem CID 173165534) has the molecular formula C22H25BrNOP
and a molecular weight of 430.33 g/mol. Its IUPAC name is N-ethyl-1-[methyl(triphenyl)-λ5-phosphanyl]formamide;hydrobromide.
Molecular Properties
| Compound Name | N-ethyl-1-[methyl(triphenyl)-λ5-phosphanyl]formamide;hydrobromide |
| PubChem CID | 173165534 |
| Molecular Formula | C22H25BrNOP |
| Molecular Weight | 430.33 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | N-ethyl-1-[methyl(triphenyl)-λ5-phosphanyl]formamide;hydrobromide |
| SMILES | Br.CCNC(=O)P(C)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H24NOP.BrH/c1-3-23-22(24)25(2,19-13-7-4-8-14-19,20-15-9-5-10-16-20)21-17-11-6-12-18-21;/h4-18H,3H2,1-2H3,(H,23,24);1H |
| InChIKey | WLAVWUCWUDPTCQ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.33 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-1-[methyl(triphenyl)-λ5-phosphanyl]formamide;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-1-[methyl(triphenyl)-λ5-phosphanyl]formamide;hydrobromide?
The IUPAC name of N-ethyl-1-[methyl(triphenyl)-λ5-phosphanyl]formamide;hydrobromide (CID 173165534) is N-ethyl-1-[methyl(triphenyl)-λ5-phosphanyl]formamide;hydrobromide.
What is the SMILES notation for N-ethyl-1-[methyl(triphenyl)-λ5-phosphanyl]formamide;hydrobromide?
The canonical SMILES for N-ethyl-1-[methyl(triphenyl)-λ5-phosphanyl]formamide;hydrobromide is Br.CCNC(=O)P(C)(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of N-ethyl-1-[methyl(triphenyl)-λ5-phosphanyl]formamide;hydrobromide?
The InChIKey is WLAVWUCWUDPTCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24NOP.BrH/c1-3-23-22(24)25(2,19-13-7-4-8-14-19,20-15-9-5-10-16-20)21-17-11-6-12-18-21;/h4-18H,3H2,1-2H3,(H,23,24);1H.
What are the key properties of N-ethyl-1-[methyl(triphenyl)-λ5-phosphanyl]formamide;hydrobromide?
N-ethyl-1-[methyl(triphenyl)-λ5-phosphanyl]formamide;hydrobromide has a molecular weight of 430.33 g/mol, XLogP of 4.45, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-1-[methyl(triphenyl)-λ5-phosphanyl]formamide;hydrobromide is sourced from PubChem (CID 173165534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).