C20H20O7S — CID 173173922
(E)-4-(4-hydroxy-3-methoxyphenyl)-4-[2-(4-hydroxy-3-methoxyphenyl)ethenylsulfonyl]but-3-en-2-one (PubChem CID 173173922) has the molecular formula C20H20O7S and a molecular weight of 404.44 g/mol. Its IUPAC name is (E)-4-(4-hydroxy-3-methoxyphenyl)-4-[2-(4-hydroxy-3-methoxyphenyl)ethenylsulfonyl]but-3-en-2-one.
| Compound Name | (E)-4-(4-hydroxy-3-methoxyphenyl)-4-[2-(4-hydroxy-3-methoxyphenyl)ethenylsulfonyl]but-3-en-2-one |
|---|---|
| PubChem CID | 173173922 |
| Molecular Formula | C20H20O7S |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | (E)-4-(4-hydroxy-3-methoxyphenyl)-4-[2-(4-hydroxy-3-methoxyphenyl)ethenylsulfonyl]but-3-en-2-one |
| SMILES | COc1cc(C=CS(=O)(=O)/C(=C/C(C)=O)c2ccc(O)c(OC)c2)ccc1O |
| InChI | InChI=1S/C20H20O7S/c1-13(21)10-20(15-5-7-17(23)19(12-15)27-3)28(24,25)9-8-14-4-6-16(22)18(11-14)26-2/h4-12,22-23H,1-3H3/b9-8?,20-10+ |
| InChIKey | DLJHKWXAMFJYCY-XEPBRWBGSA-N |
| XLogP | 3.13 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|