C19H19NO7S — CID 66992644
3-(4-hydroxy-3-methoxyphenyl)-N-[2-(4-hydroxy-3-methoxyphenyl)ethenylsulfonyl]prop-2-enamide (PubChem CID 66992644) has the molecular formula C19H19NO7S and a molecular weight of 405.43 g/mol. Its IUPAC name is 3-(4-hydroxy-3-methoxyphenyl)-N-[2-(4-hydroxy-3-methoxyphenyl)ethenylsulfonyl]prop-2-enamide.
| Compound Name | 3-(4-hydroxy-3-methoxyphenyl)-N-[2-(4-hydroxy-3-methoxyphenyl)ethenylsulfonyl]prop-2-enamide |
|---|---|
| PubChem CID | 66992644 |
| Molecular Formula | C19H19NO7S |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | 3-(4-hydroxy-3-methoxyphenyl)-N-[2-(4-hydroxy-3-methoxyphenyl)ethenylsulfonyl]prop-2-enamide |
| SMILES | COc1cc(C=CC(=O)NS(=O)(=O)C=Cc2ccc(O)c(OC)c2)ccc1O |
| InChI | InChI=1S/C19H19NO7S/c1-26-17-11-13(3-6-15(17)21)5-8-19(23)20-28(24,25)10-9-14-4-7-16(22)18(12-14)27-2/h3-12,21-22H,1-2H3,(H,20,23) |
| InChIKey | UEGNGGVBBDAZMF-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|