C12H24O3Si — CID 173174133
2-(1-dimethylsilyloxy-2,2-dimethylpropyl)oxan-4-one (PubChem CID 173174133) has the molecular formula C12H24O3Si and a molecular weight of 244.41 g/mol. Its IUPAC name is 2-(1-dimethylsilyloxy-2,2-dimethylpropyl)oxan-4-one.
| Compound Name | 2-(1-dimethylsilyloxy-2,2-dimethylpropyl)oxan-4-one |
|---|---|
| PubChem CID | 173174133 |
| Molecular Formula | C12H24O3Si |
| Molecular Weight | 244.41 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | 2-(1-dimethylsilyloxy-2,2-dimethylpropyl)oxan-4-one |
| SMILES | C[SiH](C)OC(C1CC(=O)CCO1)C(C)(C)C |
| InChI | InChI=1S/C12H24O3Si/c1-12(2,3)11(15-16(4)5)10-8-9(13)6-7-14-10/h10-11,16H,6-8H2,1-5H3 |
| InChIKey | NXJFXIPAXTUQOD-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.41 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|