C17H33NO4Si — CID 173083476
tert-butyl (3S,4S)-3-(1-dimethylsilyloxy-2,2-dimethylpropyl)-4-formylpyrrolidine-1-carboxylate (PubChem CID 173083476) has the molecular formula C17H33NO4Si and a molecular weight of 343.54 g/mol. Its IUPAC name is tert-butyl (3S,4S)-3-(1-dimethylsilyloxy-2,2-dimethylpropyl)-4-formylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S,4S)-3-(1-dimethylsilyloxy-2,2-dimethylpropyl)-4-formylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 173083476 |
| Molecular Formula | C17H33NO4Si |
| Molecular Weight | 343.54 g/mol |
| Exact Mass | 343.22 |
| IUPAC Name | tert-butyl (3S,4S)-3-(1-dimethylsilyloxy-2,2-dimethylpropyl)-4-formylpyrrolidine-1-carboxylate |
| SMILES | C[SiH](C)OC([C@@H]1CN(C(=O)OC(C)(C)C)C[C@H]1C=O)C(C)(C)C |
| InChI | InChI=1S/C17H33NO4Si/c1-16(2,3)14(22-23(7)8)13-10-18(9-12(13)11-19)15(20)21-17(4,5)6/h11-14,23H,9-10H2,1-8H3/t12-,13+,14?/m0/s1 |
| InChIKey | CJOARYWBDURXSM-WLDKUNSKSA-N |
| XLogP | 3.08 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.54 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|