C26H47NO2 — CID 173189237
N,N-diethylethanamine;icosa-5,8,11,14-tetraenoic acid (PubChem CID 173189237) has the molecular formula C26H47NO2 and a molecular weight of 405.67 g/mol. Its IUPAC name is N,N-diethylethanamine;icosa-5,8,11,14-tetraenoic acid.
| Compound Name | N,N-diethylethanamine;icosa-5,8,11,14-tetraenoic acid |
|---|---|
| PubChem CID | 173189237 |
| Molecular Formula | C26H47NO2 |
| Molecular Weight | 405.67 g/mol |
| Exact Mass | 405.36 |
| IUPAC Name | N,N-diethylethanamine;icosa-5,8,11,14-tetraenoic acid |
| SMILES | CCCCCC=CCC=CCC=CCC=CCCCC(=O)O.CCN(CC)CC |
| InChI | InChI=1S/C20H32O2.C6H15N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22;1-4-7(5-2)6-3/h6-7,9-10,12-13,15-16H,2-5,8,11,14,17-19H2,1H3,(H,21,22);4-6H2,1-3H3 |
| InChIKey | ZWQFZLRUUXGOGH-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.67 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|