C24H42N2O2 — CID 173189354
icosa-5,8,11,14-tetraenoic acid;piperazine (PubChem CID 173189354) has the molecular formula C24H42N2O2 and a molecular weight of 390.61 g/mol. Its IUPAC name is icosa-5,8,11,14-tetraenoic acid;piperazine.
| Compound Name | icosa-5,8,11,14-tetraenoic acid;piperazine |
|---|---|
| PubChem CID | 173189354 |
| Molecular Formula | C24H42N2O2 |
| Molecular Weight | 390.61 g/mol |
| Exact Mass | 390.32 |
| IUPAC Name | icosa-5,8,11,14-tetraenoic acid;piperazine |
| SMILES | C1CNCCN1.CCCCCC=CCC=CCC=CCC=CCCCC(=O)O |
| InChI | InChI=1S/C20H32O2.C4H10N2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22;1-2-6-4-3-5-1/h6-7,9-10,12-13,15-16H,2-5,8,11,14,17-19H2,1H3,(H,21,22);5-6H,1-4H2 |
| InChIKey | YMHVLVCKAQXANY-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.61 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|