C20H19ClO — CID 173189744
1-chloro-4-[6-methoxy-2-(3-methylphenyl)cyclohexa-1,5-dien-1-yl]benzene (PubChem CID 173189744) has the molecular formula C20H19ClO and a molecular weight of 310.82 g/mol. Its IUPAC name is 1-chloro-4-[6-methoxy-2-(3-methylphenyl)cyclohexa-1,5-dien-1-yl]benzene.
| Compound Name | 1-chloro-4-[6-methoxy-2-(3-methylphenyl)cyclohexa-1,5-dien-1-yl]benzene |
|---|---|
| PubChem CID | 173189744 |
| Molecular Formula | C20H19ClO |
| Molecular Weight | 310.82 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 1-chloro-4-[6-methoxy-2-(3-methylphenyl)cyclohexa-1,5-dien-1-yl]benzene |
| SMILES | COC1=CCCC(c2cccc(C)c2)=C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H19ClO/c1-14-5-3-6-16(13-14)18-7-4-8-19(22-2)20(18)15-9-11-17(21)12-10-15/h3,5-6,8-13H,4,7H2,1-2H3 |
| InChIKey | RASGCUGBSMDICI-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.82 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|