C27H34O5P+ — CID 173195008
(4-tert-butyl-2,6-dimethylbenzoyl)-[1-(2,4-dimethoxybenzoyl)cyclopentyl]-oxophosphanium (PubChem CID 173195008) has the molecular formula C27H34O5P+ and a molecular weight of 469.54 g/mol. Its IUPAC name is (4-tert-butyl-2,6-dimethylbenzoyl)-[1-(2,4-dimethoxybenzoyl)cyclopentyl]-oxophosphanium.
| Compound Name | (4-tert-butyl-2,6-dimethylbenzoyl)-[1-(2,4-dimethoxybenzoyl)cyclopentyl]-oxophosphanium |
|---|---|
| PubChem CID | 173195008 |
| Molecular Formula | C27H34O5P+ |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | (4-tert-butyl-2,6-dimethylbenzoyl)-[1-(2,4-dimethoxybenzoyl)cyclopentyl]-oxophosphanium |
| SMILES | COc1ccc(C(=O)C2([P+](=O)C(=O)c3c(C)cc(C(C)(C)C)cc3C)CCCC2)c(OC)c1 |
| InChI | InChI=1S/C27H34O5P/c1-17-14-19(26(3,4)5)15-18(2)23(17)25(29)33(30)27(12-8-9-13-27)24(28)21-11-10-20(31-6)16-22(21)32-7/h10-11,14-16H,8-9,12-13H2,1-7H3/q+1 |
| InChIKey | RUKOEFSIDRDXLC-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|