C10H7F2NO3 — CID 173202315
3-(2,3-difluorophenyl)-3-hydroxy-2-methanimidoylprop-2-enoic acid (PubChem CID 173202315) has the molecular formula C10H7F2NO3 and a molecular weight of 227.17 g/mol. Its IUPAC name is 3-(2,3-difluorophenyl)-3-hydroxy-2-methanimidoylprop-2-enoic acid.
| Compound Name | 3-(2,3-difluorophenyl)-3-hydroxy-2-methanimidoylprop-2-enoic acid |
|---|---|
| PubChem CID | 173202315 |
| Molecular Formula | C10H7F2NO3 |
| Molecular Weight | 227.17 g/mol |
| Exact Mass | 227.04 |
| IUPAC Name | 3-(2,3-difluorophenyl)-3-hydroxy-2-methanimidoylprop-2-enoic acid |
| SMILES | [H]/N=C/C(C(=O)O)=C(O)c1cccc(F)c1F |
| InChI | InChI=1S/C10H7F2NO3/c11-7-3-1-2-5(8(7)12)9(14)6(4-13)10(15)16/h1-4,13-14H,(H,15,16)/b9-6?,13-4+ |
| InChIKey | WBJSMDSSSZKXQQ-MYOOXAKISA-N |
| XLogP | 1.97 |
| TPSA | 81.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.17 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|