C22H32O2 — CID 173205709
5-methyl-2,4-bis(3-methylbut-2-enyl)-3-pent-2-en-3-yloxyphenol (PubChem CID 173205709) has the molecular formula C22H32O2 and a molecular weight of 328.50 g/mol. Its IUPAC name is 5-methyl-2,4-bis(3-methylbut-2-enyl)-3-pent-2-en-3-yloxyphenol.
| Compound Name | 5-methyl-2,4-bis(3-methylbut-2-enyl)-3-pent-2-en-3-yloxyphenol |
|---|---|
| PubChem CID | 173205709 |
| Molecular Formula | C22H32O2 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | 5-methyl-2,4-bis(3-methylbut-2-enyl)-3-pent-2-en-3-yloxyphenol |
| SMILES | CC=C(CC)Oc1c(CC=C(C)C)c(C)cc(O)c1CC=C(C)C |
| InChI | InChI=1S/C22H32O2/c1-8-18(9-2)24-22-19(12-10-15(3)4)17(7)14-21(23)20(22)13-11-16(5)6/h8,10-11,14,23H,9,12-13H2,1-7H3 |
| InChIKey | OSEDMERWRQXSPO-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|