C9H16OSi — CID 173207976
[cyclopenta-1,4-dien-1-yl(methoxy)methyl]-dimethylsilane (PubChem CID 173207976) has the molecular formula C9H16OSi and a molecular weight of 168.31 g/mol. Its IUPAC name is [cyclopenta-1,4-dien-1-yl(methoxy)methyl]-dimethylsilane.
| Compound Name | [cyclopenta-1,4-dien-1-yl(methoxy)methyl]-dimethylsilane |
|---|---|
| PubChem CID | 173207976 |
| Molecular Formula | C9H16OSi |
| Molecular Weight | 168.31 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | [cyclopenta-1,4-dien-1-yl(methoxy)methyl]-dimethylsilane |
| SMILES | COC(C1=CCC=C1)[SiH](C)C |
| InChI | InChI=1S/C9H16OSi/c1-10-9(11(2)3)8-6-4-5-7-8/h4,6-7,9,11H,5H2,1-3H3 |
| InChIKey | XHYJJJHMVWBLMM-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.31 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|