C34H35FN6O7 — CID 173211155
benzyl N-[3-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]-3-azabicyclo[3.1.0]hexan-6-yl]-N-(N-phenylmethoxycarbonylcarbamimidoyl)carbamate (PubChem CID 173211155) has the molecular formula C34H35FN6O7 and a molecular weight of 658.69 g/mol. Its IUPAC name is benzyl N-[3-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]-3-azabicyclo[3.1.0]hexan-6-yl]-N-(N-phenylmethoxycarbonylcarbamimidoyl)carbamate.
| Compound Name | benzyl N-[3-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]-3-azabicyclo[3.1.0]hexan-6-yl]-N-(N-phenylmethoxycarbonylcarbamimidoyl)carbamate |
|---|---|
| PubChem CID | 173211155 |
| Molecular Formula | C34H35FN6O7 |
| Molecular Weight | 658.69 g/mol |
| Exact Mass | 658.26 |
| IUPAC Name | benzyl N-[3-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]-3-azabicyclo[3.1.0]hexan-6-yl]-N-(N-phenylmethoxycarbonylcarbamimidoyl)carbamate |
| SMILES | [H]/N=C(\NC(=O)OCc1ccccc1)N(C(=O)OCc1ccccc1)C1C2CN(c3ccc(N4C[C@H](CNC(C)=O)OC4=O)cc3F)CC21 |
| InChI | InChI=1S/C34H35FN6O7/c1-21(42)37-15-25-16-40(33(44)48-25)24-12-13-29(28(35)14-24)39-17-26-27(18-39)30(26)41(34(45)47-20-23-10-6-3-7-11-23)31(36)38-32(43)46-19-22-8-4-2-5-9-22/h2-14,25-27,30H,15-20H2,1H3,(H,37,42)(H2,36,38,43)/t25-,26?,27?,30?/m0/s1 |
| InChIKey | AXWWYWPXNKKIOM-XDXSXCENSA-N |
| XLogP | 4.22 |
| TPSA | 153.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.69 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|