C21H29ClN6O2 — CID 173211304
2-[4-[5-[2-(2,5-diaminophenoxy)ethyl]imidazol-1-yl]butoxy]benzene-1,4-diamine;hydrochloride (PubChem CID 173211304) has the molecular formula C21H29ClN6O2 and a molecular weight of 432.96 g/mol. Its IUPAC name is 2-[4-[5-[2-(2,5-diaminophenoxy)ethyl]imidazol-1-yl]butoxy]benzene-1,4-diamine;hydrochloride.
| Compound Name | 2-[4-[5-[2-(2,5-diaminophenoxy)ethyl]imidazol-1-yl]butoxy]benzene-1,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 173211304 |
| Molecular Formula | C21H29ClN6O2 |
| Molecular Weight | 432.96 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | 2-[4-[5-[2-(2,5-diaminophenoxy)ethyl]imidazol-1-yl]butoxy]benzene-1,4-diamine;hydrochloride |
| SMILES | Cl.Nc1ccc(N)c(OCCCCn2cncc2CCOc2cc(N)ccc2N)c1 |
| InChI | InChI=1S/C21H28N6O2.ClH/c22-15-3-5-18(24)20(11-15)28-9-2-1-8-27-14-26-13-17(27)7-10-29-21-12-16(23)4-6-19(21)25;/h3-6,11-14H,1-2,7-10,22-25H2;1H |
| InChIKey | BUQASOQIBCDIHQ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 140.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.96 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|