C21H29N6O2+ — CID 87456420
2-[3-[4-[2-(2,5-diaminophenoxy)ethyl]-3-methylimidazol-1-ium-1-yl]propoxy]benzene-1,4-diamine (PubChem CID 87456420) has the molecular formula C21H29N6O2+ and a molecular weight of 397.50 g/mol. Its IUPAC name is 2-[3-[4-[2-(2,5-diaminophenoxy)ethyl]-3-methylimidazol-1-ium-1-yl]propoxy]benzene-1,4-diamine.
| Compound Name | 2-[3-[4-[2-(2,5-diaminophenoxy)ethyl]-3-methylimidazol-1-ium-1-yl]propoxy]benzene-1,4-diamine |
|---|---|
| PubChem CID | 87456420 |
| Molecular Formula | C21H29N6O2+ |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | 2-[3-[4-[2-(2,5-diaminophenoxy)ethyl]-3-methylimidazol-1-ium-1-yl]propoxy]benzene-1,4-diamine |
| SMILES | Cn1c[n+](CCCOc2cc(N)ccc2N)cc1CCOc1cc(N)ccc1N |
| InChI | InChI=1S/C21H29N6O2/c1-26-14-27(8-2-9-28-20-11-15(22)3-5-18(20)24)13-17(26)7-10-29-21-12-16(23)4-6-19(21)25/h3-6,11-14H,2,7-10,22-25H2,1H3/q+1 |
| InChIKey | MVLUFIUBHJOABU-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 131.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|