About N-nitrosoethanimine oxide
N-nitrosoethanimine oxide (PubChem CID 173221529) has the molecular formula C2H4N2O2
and a molecular weight of 88.07 g/mol. Its IUPAC name is N-nitrosoethanimine oxide.
Molecular Properties
| Compound Name | N-nitrosoethanimine oxide |
| PubChem CID | 173221529 |
| Molecular Formula | C2H4N2O2 |
| Molecular Weight | 88.07 g/mol |
| Exact Mass | 88.03 |
| IUPAC Name | N-nitrosoethanimine oxide |
| SMILES | C/C=[N+](\[O-])N=O |
| InChI | InChI=1S/C2H4N2O2/c1-2-4(6)3-5/h2H,1H3/b4-2- |
| InChIKey | UZSRXOGBGOJAJA-RQOWECAXSA-N |
| XLogP | 0.27 |
| TPSA | 55.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 88.07 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze N-nitrosoethanimine oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-nitrosoethanimine oxide?
The IUPAC name of N-nitrosoethanimine oxide (CID 173221529) is N-nitrosoethanimine oxide.
What is the SMILES notation for N-nitrosoethanimine oxide?
The canonical SMILES for N-nitrosoethanimine oxide is C/C=[N+](\[O-])N=O.
What is the InChIKey of N-nitrosoethanimine oxide?
The InChIKey is UZSRXOGBGOJAJA-RQOWECAXSA-N. The full InChI is InChI=1S/C2H4N2O2/c1-2-4(6)3-5/h2H,1H3/b4-2-.
What are the key properties of N-nitrosoethanimine oxide?
N-nitrosoethanimine oxide has a molecular weight of 88.07 g/mol, XLogP of 0.27, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-nitrosoethanimine oxide is sourced from PubChem (CID 173221529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).