About N-propylidenenitramide
N-propylidenenitramide (PubChem CID 173232396) has the molecular formula C3H6N2O2
and a molecular weight of 102.09 g/mol. Its IUPAC name is N-propylidenenitramide.
Molecular Properties
| Compound Name | N-propylidenenitramide |
| PubChem CID | 173232396 |
| Molecular Formula | C3H6N2O2 |
| Molecular Weight | 102.09 g/mol |
| Exact Mass | 102.04 |
| IUPAC Name | N-propylidenenitramide |
| SMILES | CCC=N[N+](=O)[O-] |
| InChI | InChI=1S/C3H6N2O2/c1-2-3-4-5(6)7/h3H,2H2,1H3 |
| InChIKey | BUGUODZGUKOSSF-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 55.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 102.09 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-propylidenenitramide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propylidenenitramide?
The IUPAC name of N-propylidenenitramide (CID 173232396) is N-propylidenenitramide.
What is the SMILES notation for N-propylidenenitramide?
The canonical SMILES for N-propylidenenitramide is CCC=N[N+](=O)[O-].
What is the InChIKey of N-propylidenenitramide?
The InChIKey is BUGUODZGUKOSSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6N2O2/c1-2-3-4-5(6)7/h3H,2H2,1H3.
What are the key properties of N-propylidenenitramide?
N-propylidenenitramide has a molecular weight of 102.09 g/mol, XLogP of 0.66, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-propylidenenitramide is sourced from PubChem (CID 173232396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).