C13H9F5NNaO4S — CID 173238277
sodium;hydride;2,3,4,5,6-pentafluoro-N-(2-hydroxy-3-methoxyphenyl)benzenesulfonamide (PubChem CID 173238277) has the molecular formula C13H9F5NNaO4S and a molecular weight of 393.27 g/mol. Its IUPAC name is sodium;hydride;2,3,4,5,6-pentafluoro-N-(2-hydroxy-3-methoxyphenyl)benzenesulfonamide.
| Compound Name | sodium;hydride;2,3,4,5,6-pentafluoro-N-(2-hydroxy-3-methoxyphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 173238277 |
| Molecular Formula | C13H9F5NNaO4S |
| Molecular Weight | 393.27 g/mol |
| Exact Mass | 393.01 |
| IUPAC Name | sodium;hydride;2,3,4,5,6-pentafluoro-N-(2-hydroxy-3-methoxyphenyl)benzenesulfonamide |
| SMILES | COc1cccc(NS(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)c1O.[H-].[Na+] |
| InChI | InChI=1S/C13H8F5NO4S.Na.H/c1-23-6-4-2-3-5(12(6)20)19-24(21,22)13-10(17)8(15)7(14)9(16)11(13)18;;/h2-4,19-20H,1H3;;/q;+1;-1 |
| InChIKey | WRWAATJRYKNWIJ-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.27 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|