About (1E)-1-(cycloundecen-1-yl)-3-diazocycloundecene;2-ethylhexanoic acid
(1E)-1-(cycloundecen-1-yl)-3-diazocycloundecene;2-ethylhexanoic acid (PubChem CID 173240971) has the molecular formula C30H52N2O2
and a molecular weight of 472.76 g/mol. Its IUPAC name is (1E)-1-(cycloundecen-1-yl)-3-diazocycloundecene;2-ethylhexanoic acid.
Molecular Properties
| Compound Name | (1E)-1-(cycloundecen-1-yl)-3-diazocycloundecene;2-ethylhexanoic acid |
| PubChem CID | 173240971 |
| Molecular Formula | C30H52N2O2 |
| Molecular Weight | 472.76 g/mol |
| Exact Mass | 472.40 |
| IUPAC Name | (1E)-1-(cycloundecen-1-yl)-3-diazocycloundecene;2-ethylhexanoic acid |
| SMILES | CCCCC(CC)C(=O)O.[N-]=[N+]=C1/C=C(/C2=CCCCCCCCCC2)CCCCCCCC1 |
| InChI | InChI=1S/C22H36N2.C8H16O2/c23-24-22-18-14-10-6-5-9-13-17-21(19-22)20-15-11-7-3-1-2-4-8-12-16-20;1-3-5-6-7(4-2)8(9)10/h15,19H,1-14,16-18H2;7H,3-6H2,1-2H3,(H,9,10)/b20-15?,21-19+; |
| InChIKey | JVDYJFIYUCKXDS-QOTRNHFLSA-N |
| XLogP | 9.46 |
| TPSA | 73.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 472.76 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze (1E)-1-(cycloundecen-1-yl)-3-diazocycloundecene;2-ethylhexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E)-1-(cycloundecen-1-yl)-3-diazocycloundecene;2-ethylhexanoic acid?
The IUPAC name of (1E)-1-(cycloundecen-1-yl)-3-diazocycloundecene;2-ethylhexanoic acid (CID 173240971) is (1E)-1-(cycloundecen-1-yl)-3-diazocycloundecene;2-ethylhexanoic acid.
What is the SMILES notation for (1E)-1-(cycloundecen-1-yl)-3-diazocycloundecene;2-ethylhexanoic acid?
The canonical SMILES for (1E)-1-(cycloundecen-1-yl)-3-diazocycloundecene;2-ethylhexanoic acid is CCCCC(CC)C(=O)O.[N-]=[N+]=C1/C=C(/C2=CCCCCCCCCC2)CCCCCCCC1.
What is the InChIKey of (1E)-1-(cycloundecen-1-yl)-3-diazocycloundecene;2-ethylhexanoic acid?
The InChIKey is JVDYJFIYUCKXDS-QOTRNHFLSA-N. The full InChI is InChI=1S/C22H36N2.C8H16O2/c23-24-22-18-14-10-6-5-9-13-17-21(19-22)20-15-11-7-3-1-2-4-8-12-16-20;1-3-5-6-7(4-2)8(9)10/h15,19H,1-14,16-18H2;7H,3-6H2,1-2H3,(H,9,10)/b20-15?,21-19+;.
What are the key properties of (1E)-1-(cycloundecen-1-yl)-3-diazocycloundecene;2-ethylhexanoic acid?
(1E)-1-(cycloundecen-1-yl)-3-diazocycloundecene;2-ethylhexanoic acid has a molecular weight of 472.76 g/mol, XLogP of 9.46, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1E)-1-(cycloundecen-1-yl)-3-diazocycloundecene;2-ethylhexanoic acid is sourced from PubChem (CID 173240971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).