C30H38N2O8 — CID 173241085
but-2-enedioic acid;N-[[5,6-dimethoxy-3-[1-(2-phenylethyl)piperidin-4-yl]-3,4-dihydro-1H-isochromen-1-yl]methyl]formamide (PubChem CID 173241085) has the molecular formula C30H38N2O8 and a molecular weight of 554.64 g/mol. Its IUPAC name is but-2-enedioic acid;N-[[5,6-dimethoxy-3-[1-(2-phenylethyl)piperidin-4-yl]-3,4-dihydro-1H-isochromen-1-yl]methyl]formamide.
| Compound Name | but-2-enedioic acid;N-[[5,6-dimethoxy-3-[1-(2-phenylethyl)piperidin-4-yl]-3,4-dihydro-1H-isochromen-1-yl]methyl]formamide |
|---|---|
| PubChem CID | 173241085 |
| Molecular Formula | C30H38N2O8 |
| Molecular Weight | 554.64 g/mol |
| Exact Mass | 554.26 |
| IUPAC Name | but-2-enedioic acid;N-[[5,6-dimethoxy-3-[1-(2-phenylethyl)piperidin-4-yl]-3,4-dihydro-1H-isochromen-1-yl]methyl]formamide |
| SMILES | COc1ccc2c(c1OC)CC(C1CCN(CCc3ccccc3)CC1)OC2CNC=O.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C26H34N2O4.C4H4O4/c1-30-23-9-8-21-22(26(23)31-2)16-24(32-25(21)17-27-18-29)20-11-14-28(15-12-20)13-10-19-6-4-3-5-7-19;5-3(6)1-2-4(7)8/h3-9,18,20,24-25H,10-17H2,1-2H3,(H,27,29);1-2H,(H,5,6)(H,7,8) |
| InChIKey | SOJOHWMLBCXMHU-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 134.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.64 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|