C17H19ClLiO2P — CID 173244490
lithium;(2-chloro-4-propoxyphenyl)phosphanyl-(2-methylphenyl)methanone;hydride (PubChem CID 173244490) has the molecular formula C17H19ClLiO2P and a molecular weight of 328.70 g/mol. Its IUPAC name is lithium;(2-chloro-4-propoxyphenyl)phosphanyl-(2-methylphenyl)methanone;hydride.
| Compound Name | lithium;(2-chloro-4-propoxyphenyl)phosphanyl-(2-methylphenyl)methanone;hydride |
|---|---|
| PubChem CID | 173244490 |
| Molecular Formula | C17H19ClLiO2P |
| Molecular Weight | 328.70 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | lithium;(2-chloro-4-propoxyphenyl)phosphanyl-(2-methylphenyl)methanone;hydride |
| SMILES | CCCOc1ccc(PC(=O)c2ccccc2C)c(Cl)c1.[H-].[Li+] |
| InChI | InChI=1S/C17H18ClO2P.Li.H/c1-3-10-20-13-8-9-16(15(18)11-13)21-17(19)14-7-5-4-6-12(14)2;;/h4-9,11,21H,3,10H2,1-2H3;;/q;+1;-1 |
| InChIKey | AGOJJQKRGKPDOJ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.70 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|