C18H20ClO2P — CID 18515249
(4-butoxy-2-chlorophenyl)phosphanyl-(2-methylphenyl)methanone (PubChem CID 18515249) has the molecular formula C18H20ClO2P and a molecular weight of 334.78 g/mol. Its IUPAC name is (4-butoxy-2-chlorophenyl)phosphanyl-(2-methylphenyl)methanone.
| Compound Name | (4-butoxy-2-chlorophenyl)phosphanyl-(2-methylphenyl)methanone |
|---|---|
| PubChem CID | 18515249 |
| Molecular Formula | C18H20ClO2P |
| Molecular Weight | 334.78 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | (4-butoxy-2-chlorophenyl)phosphanyl-(2-methylphenyl)methanone |
| SMILES | CCCCOc1ccc(PC(=O)c2ccccc2C)c(Cl)c1 |
| InChI | InChI=1S/C18H20ClO2P/c1-3-4-11-21-14-9-10-17(16(19)12-14)22-18(20)15-8-6-5-7-13(15)2/h5-10,12,22H,3-4,11H2,1-2H3 |
| InChIKey | WRIZTSYSYVSZCF-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.78 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|