C15H32N2O6S — CID 173247708
sulfuric acid;N-(2,2,6,6-tetraethyl-1-hydroxypiperidin-4-yl)acetamide (PubChem CID 173247708) has the molecular formula C15H32N2O6S and a molecular weight of 368.50 g/mol. Its IUPAC name is sulfuric acid;N-(2,2,6,6-tetraethyl-1-hydroxypiperidin-4-yl)acetamide.
| Compound Name | sulfuric acid;N-(2,2,6,6-tetraethyl-1-hydroxypiperidin-4-yl)acetamide |
|---|---|
| PubChem CID | 173247708 |
| Molecular Formula | C15H32N2O6S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | sulfuric acid;N-(2,2,6,6-tetraethyl-1-hydroxypiperidin-4-yl)acetamide |
| SMILES | CCC1(CC)CC(NC(C)=O)CC(CC)(CC)N1O.O=S(=O)(O)O |
| InChI | InChI=1S/C15H30N2O2.H2O4S/c1-6-14(7-2)10-13(16-12(5)18)11-15(8-3,9-4)17(14)19;1-5(2,3)4/h13,19H,6-11H2,1-5H3,(H,16,18);(H2,1,2,3,4) |
| InChIKey | SDLPWTNTSOGBRI-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|