C13H22N4O4 — CID 173254013
(3S)-3-[8-(diaminomethylideneamino)oct-2-enoylamino]-4-oxobutanoic acid (PubChem CID 173254013) has the molecular formula C13H22N4O4 and a molecular weight of 298.34 g/mol. Its IUPAC name is (3S)-3-[8-(diaminomethylideneamino)oct-2-enoylamino]-4-oxobutanoic acid.
| Compound Name | (3S)-3-[8-(diaminomethylideneamino)oct-2-enoylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 173254013 |
| Molecular Formula | C13H22N4O4 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | (3S)-3-[8-(diaminomethylideneamino)oct-2-enoylamino]-4-oxobutanoic acid |
| SMILES | NC(N)=NCCCCCC=CC(=O)N[C@H](C=O)CC(=O)O |
| InChI | InChI=1S/C13H22N4O4/c14-13(15)16-7-5-3-1-2-4-6-11(19)17-10(9-18)8-12(20)21/h4,6,9-10H,1-3,5,7-8H2,(H,17,19)(H,20,21)(H4,14,15,16)/t10-/m0/s1 |
| InChIKey | ACVOCZYNTYSSIB-JTQLQIEISA-N |
| XLogP | -0.47 |
| TPSA | 147.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|