C18H32N4O4 — CID 143918640
(2S)-5-(diaminomethylideneamino)-2-[[(2E,4E,11S)-11-hydroxydodeca-2,4-dienoyl]amino]pentanoic acid (PubChem CID 143918640) has the molecular formula C18H32N4O4 and a molecular weight of 368.48 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-2-[[(2E,4E,11S)-11-hydroxydodeca-2,4-dienoyl]amino]pentanoic acid.
| Compound Name | (2S)-5-(diaminomethylideneamino)-2-[[(2E,4E,11S)-11-hydroxydodeca-2,4-dienoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 143918640 |
| Molecular Formula | C18H32N4O4 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-2-[[(2E,4E,11S)-11-hydroxydodeca-2,4-dienoyl]amino]pentanoic acid |
| SMILES | C[C@H](O)CCCCC/C=C/C=C/C(=O)N[C@@H](CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C18H32N4O4/c1-14(23)10-7-5-3-2-4-6-8-12-16(24)22-15(17(25)26)11-9-13-21-18(19)20/h4,6,8,12,14-15,23H,2-3,5,7,9-11,13H2,1H3,(H,22,24)(H,25,26)(H4,19,20,21)/b6-4+,12-8+/t14-,15-/m0/s1 |
| InChIKey | AEVHHRLBCNLXER-FPAHOTOMSA-N |
| XLogP | 1.05 |
| TPSA | 151.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|