C21H36N4O4 — CID 59293973
(2S)-5-(diaminomethylideneamino)-2-[[(2E,4E)-13-methyl-11-oxotetradeca-2,4-dienoyl]amino]pentanoic acid (PubChem CID 59293973) has the molecular formula C21H36N4O4 and a molecular weight of 408.54 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-2-[[(2E,4E)-13-methyl-11-oxotetradeca-2,4-dienoyl]amino]pentanoic acid.
| Compound Name | (2S)-5-(diaminomethylideneamino)-2-[[(2E,4E)-13-methyl-11-oxotetradeca-2,4-dienoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 59293973 |
| Molecular Formula | C21H36N4O4 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.27 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-2-[[(2E,4E)-13-methyl-11-oxotetradeca-2,4-dienoyl]amino]pentanoic acid |
| SMILES | CC(C)CC(=O)CCCCC/C=C/C=C/C(=O)N[C@@H](CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C21H36N4O4/c1-16(2)15-17(26)11-8-6-4-3-5-7-9-13-19(27)25-18(20(28)29)12-10-14-24-21(22)23/h5,7,9,13,16,18H,3-4,6,8,10-12,14-15H2,1-2H3,(H,25,27)(H,28,29)(H4,22,23,24)/b7-5+,13-9+/t18-/m0/s1 |
| InChIKey | SAWOHSLAUVMUOE-PKAUTIFLSA-N |
| XLogP | 2.29 |
| TPSA | 147.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|