C9H12N2O — CID 173255778
5-diazo-2,3,3a,6,7,7a-hexahydro-1H-inden-4-one (PubChem CID 173255778) has the molecular formula C9H12N2O and a molecular weight of 164.21 g/mol. Its IUPAC name is 5-diazo-2,3,3a,6,7,7a-hexahydro-1H-inden-4-one.
| Compound Name | 5-diazo-2,3,3a,6,7,7a-hexahydro-1H-inden-4-one |
|---|---|
| PubChem CID | 173255778 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | 5-diazo-2,3,3a,6,7,7a-hexahydro-1H-inden-4-one |
| SMILES | [N-]=[N+]=C1CCC2CCCC2C1=O |
| InChI | InChI=1S/C9H12N2O/c10-11-8-5-4-6-2-1-3-7(6)9(8)12/h6-7H,1-5H2 |
| InChIKey | MBASJHFGYSWLPK-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|