C8H18N4O — CID 173258768
3,4-diamino-N-(2-aminopropan-2-yl)-2-methylbut-2-enamide (PubChem CID 173258768) has the molecular formula C8H18N4O and a molecular weight of 186.26 g/mol. Its IUPAC name is 3,4-diamino-N-(2-aminopropan-2-yl)-2-methylbut-2-enamide.
| Compound Name | 3,4-diamino-N-(2-aminopropan-2-yl)-2-methylbut-2-enamide |
|---|---|
| PubChem CID | 173258768 |
| Molecular Formula | C8H18N4O |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.15 |
| IUPAC Name | 3,4-diamino-N-(2-aminopropan-2-yl)-2-methylbut-2-enamide |
| SMILES | CC(C(=O)NC(C)(C)N)=C(N)CN |
| InChI | InChI=1S/C8H18N4O/c1-5(6(10)4-9)7(13)12-8(2,3)11/h4,9-11H2,1-3H3,(H,12,13) |
| InChIKey | JEBGRUZWJISGDU-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 107.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|