C54H58Hf-2 — CID 173268253
bis(2-(3,5-ditert-butylphenyl)-1H-cyclopenta[b]naphthalen-1-ide);hafnium (PubChem CID 173268253) has the molecular formula C54H58Hf-2 and a molecular weight of 885.55 g/mol. Its IUPAC name is bis(2-(3,5-ditert-butylphenyl)-1H-cyclopenta[b]naphthalen-1-ide);hafnium.
| Compound Name | bis(2-(3,5-ditert-butylphenyl)-1H-cyclopenta[b]naphthalen-1-ide);hafnium |
|---|---|
| PubChem CID | 173268253 |
| Molecular Formula | C54H58Hf-2 |
| Molecular Weight | 885.55 g/mol |
| Exact Mass | 886.40 |
| IUPAC Name | bis(2-(3,5-ditert-butylphenyl)-1H-cyclopenta[b]naphthalen-1-ide);hafnium |
| SMILES | CC(C)(C)c1cc(-c2cc3cc4ccccc4cc3[cH-]2)cc(C(C)(C)C)c1.CC(C)(C)c1cc(-c2cc3cc4ccccc4cc3[cH-]2)cc(C(C)(C)C)c1.[Hf] |
| InChI | InChI=1S/2C27H29.Hf/c2*1-26(2,3)24-15-23(16-25(17-24)27(4,5)6)22-13-20-11-18-9-7-8-10-19(18)12-21(20)14-22;/h2*7-17H,1-6H3;/q2*-1; |
| InChIKey | DNGAHHBKUGZZOU-UHFFFAOYSA-N |
| XLogP | 15.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 885.55 |
| LogP ≤ 5 | 15.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|