C35H20Cl2F12Zr — CID 12010630
2-[3,5-bis(trifluoromethyl)phenyl]-1H-inden-1-ide;2-[3,5-bis(trifluoromethyl)phenyl]-1-methylinden-1-ide;dichlorozirconium(2+) (PubChem CID 12010630) has the molecular formula C35H20Cl2F12Zr and a molecular weight of 830.65 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)phenyl]-1H-inden-1-ide;2-[3,5-bis(trifluoromethyl)phenyl]-1-methylinden-1-ide;dichlorozirconium(2+).
| Compound Name | 2-[3,5-bis(trifluoromethyl)phenyl]-1H-inden-1-ide;2-[3,5-bis(trifluoromethyl)phenyl]-1-methylinden-1-ide;dichlorozirconium(2+) |
|---|---|
| PubChem CID | 12010630 |
| Molecular Formula | C35H20Cl2F12Zr |
| Molecular Weight | 830.65 g/mol |
| Exact Mass | 827.98 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)phenyl]-1H-inden-1-ide;2-[3,5-bis(trifluoromethyl)phenyl]-1-methylinden-1-ide;dichlorozirconium(2+) |
| SMILES | C[c-]1c(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc2ccccc21.Cl[Zr+2]Cl.FC(F)(F)c1cc(-c2cc3ccccc3[cH-]2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H11F6.C17H9F6.2ClH.Zr/c1-10-15-5-3-2-4-11(15)8-16(10)12-6-13(17(19,20)21)9-14(7-12)18(22,23)24;18-16(19,20)14-7-13(8-15(9-14)17(21,22)23)12-5-10-3-1-2-4-11(10)6-12;;;/h2-9H,1H3;1-9H;2*1H;/q2*-1;;;+4/p-2 |
| InChIKey | TXIBRKBXXVFXDT-UHFFFAOYSA-L |
| XLogP | 14.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 830.65 |
| LogP ≤ 5 | 14.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|