C16H16ClN3O2S — CID 173269497
1-(5-chloro-2,4-dimethoxyphenyl)-3-(6-cyanocyclohexa-1,5-dien-1-yl)thiourea (PubChem CID 173269497) has the molecular formula C16H16ClN3O2S and a molecular weight of 349.84 g/mol. Its IUPAC name is 1-(5-chloro-2,4-dimethoxyphenyl)-3-(6-cyanocyclohexa-1,5-dien-1-yl)thiourea.
| Compound Name | 1-(5-chloro-2,4-dimethoxyphenyl)-3-(6-cyanocyclohexa-1,5-dien-1-yl)thiourea |
|---|---|
| PubChem CID | 173269497 |
| Molecular Formula | C16H16ClN3O2S |
| Molecular Weight | 349.84 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 1-(5-chloro-2,4-dimethoxyphenyl)-3-(6-cyanocyclohexa-1,5-dien-1-yl)thiourea |
| SMILES | COc1cc(OC)c(NC(=S)NC2=CCCC=C2C#N)cc1Cl |
| InChI | InChI=1S/C16H16ClN3O2S/c1-21-14-8-15(22-2)13(7-11(14)17)20-16(23)19-12-6-4-3-5-10(12)9-18/h5-8H,3-4H2,1-2H3,(H2,19,20,23) |
| InChIKey | GFROJEOJAIYCET-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 66.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.84 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|