C8H15N2+ — CID 173271345
1,2,3,5,6,7,8,8a-octahydroquinoxalin-4-ium (PubChem CID 173271345) has the molecular formula C8H15N2+ and a molecular weight of 139.22 g/mol. Its IUPAC name is 1,2,3,5,6,7,8,8a-octahydroquinoxalin-4-ium.
| Compound Name | 1,2,3,5,6,7,8,8a-octahydroquinoxalin-4-ium |
|---|---|
| PubChem CID | 173271345 |
| Molecular Formula | C8H15N2+ |
| Molecular Weight | 139.22 g/mol |
| Exact Mass | 139.12 |
| IUPAC Name | 1,2,3,5,6,7,8,8a-octahydroquinoxalin-4-ium |
| SMILES | C1CCC2NCC[NH+]=C2C1 |
| InChI | InChI=1S/C8H14N2/c1-2-4-8-7(3-1)9-5-6-10-8/h7,9H,1-6H2/p+1 |
| InChIKey | OPQFRPHDPCEWQE-UHFFFAOYSA-O |
| XLogP | -0.95 |
| TPSA | 26.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.22 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |