C16H20N4O3 — CID 173278219
5-(2,6-dimethylmorpholin-4-yl)-3-hydroxyimino-1-methyl-1,4-benzodiazepin-2-one (PubChem CID 173278219) has the molecular formula C16H20N4O3 and a molecular weight of 316.36 g/mol. Its IUPAC name is 5-(2,6-dimethylmorpholin-4-yl)-3-hydroxyimino-1-methyl-1,4-benzodiazepin-2-one.
| Compound Name | 5-(2,6-dimethylmorpholin-4-yl)-3-hydroxyimino-1-methyl-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 173278219 |
| Molecular Formula | C16H20N4O3 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 5-(2,6-dimethylmorpholin-4-yl)-3-hydroxyimino-1-methyl-1,4-benzodiazepin-2-one |
| SMILES | CC1CN(c2nc(=NO)c(=O)n(C)c3ccccc23)CC(C)O1 |
| InChI | InChI=1S/C16H20N4O3/c1-10-8-20(9-11(2)23-10)15-12-6-4-5-7-13(12)19(3)16(21)14(17-15)18-22/h4-7,10-11,22H,8-9H2,1-3H3 |
| InChIKey | HFHHMPAGCOVDLY-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|