C30H42LiNO4S — CID 173281976
lithium;(2S)-2-[[4-(3-cyclohexylpropoxymethyl)-2-(2-methylphenyl)benzoyl]-methylamino]-4-methylsulfanylbutanoic acid;hydride (PubChem CID 173281976) has the molecular formula C30H42LiNO4S and a molecular weight of 519.68 g/mol. Its IUPAC name is lithium;(2S)-2-[[4-(3-cyclohexylpropoxymethyl)-2-(2-methylphenyl)benzoyl]-methylamino]-4-methylsulfanylbutanoic acid;hydride.
| Compound Name | lithium;(2S)-2-[[4-(3-cyclohexylpropoxymethyl)-2-(2-methylphenyl)benzoyl]-methylamino]-4-methylsulfanylbutanoic acid;hydride |
|---|---|
| PubChem CID | 173281976 |
| Molecular Formula | C30H42LiNO4S |
| Molecular Weight | 519.68 g/mol |
| Exact Mass | 519.30 |
| IUPAC Name | lithium;(2S)-2-[[4-(3-cyclohexylpropoxymethyl)-2-(2-methylphenyl)benzoyl]-methylamino]-4-methylsulfanylbutanoic acid;hydride |
| SMILES | CSCC[C@@H](C(=O)O)N(C)C(=O)c1ccc(COCCCC2CCCCC2)cc1-c1ccccc1C.[H-].[Li+] |
| InChI | InChI=1S/C30H41NO4S.Li.H/c1-22-10-7-8-14-25(22)27-20-24(21-35-18-9-13-23-11-5-4-6-12-23)15-16-26(27)29(32)31(2)28(30(33)34)17-19-36-3;;/h7-8,10,14-16,20,23,28H,4-6,9,11-13,17-19,21H2,1-3H3,(H,33,34);;/q;+1;-1/t28-;;/m0../s1 |
| InChIKey | CLBMRHHVIVTUAB-ZXVJYWQYSA-N |
| XLogP | 3.93 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.68 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|