C21H20Fe-6 — CID 173282215
2-cyclopenta-2,4-dien-1-ylpenta-2,4-dienylbenzene;cyclopentane;iron (PubChem CID 173282215) has the molecular formula C21H20Fe-6 and a molecular weight of 328.24 g/mol. Its IUPAC name is 2-cyclopenta-2,4-dien-1-ylpenta-2,4-dienylbenzene;cyclopentane;iron.
| Compound Name | 2-cyclopenta-2,4-dien-1-ylpenta-2,4-dienylbenzene;cyclopentane;iron |
|---|---|
| PubChem CID | 173282215 |
| Molecular Formula | C21H20Fe-6 |
| Molecular Weight | 328.24 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 2-cyclopenta-2,4-dien-1-ylpenta-2,4-dienylbenzene;cyclopentane;iron |
| SMILES | C=CC=C(Cc1ccccc1)[c-]1cccc1.[Fe].[cH-]1[cH-][cH-][cH-][cH-]1 |
| InChI | InChI=1S/C16H15.C5H5.Fe/c1-2-8-16(15-11-6-7-12-15)13-14-9-4-3-5-10-14;1-2-4-5-3-1;/h2-12H,1,13H2;1-5H;/q-1;-5; |
| InChIKey | JGBUDEMONUQIHO-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.24 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|