About CID 173288501
CID 173288501 (PubChem CID 173288501) has the molecular formula C8H20Br2NSn
and a molecular weight of 408.77 g/mol.
Molecular Properties
| Compound Name | CID 173288501 |
| PubChem CID | 173288501 |
| Molecular Formula | C8H20Br2NSn |
| Molecular Weight | 408.77 g/mol |
| Exact Mass | 407.90 |
| IUPAC Name | — |
| SMILES | Br.Br.CCNCC(C)CC(C)[Sn] |
| InChI | InChI=1S/C8H18N.2BrH.Sn/c1-4-6-8(3)7-9-5-2;;;/h4,8-9H,5-7H2,1-3H3;2*1H; |
| InChIKey | NQKGKWUZUCZSDK-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.77 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 173288501 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173288501?
The IUPAC name of CID 173288501 (CID 173288501) is not available.
What is the SMILES notation for CID 173288501?
The canonical SMILES for CID 173288501 is Br.Br.CCNCC(C)CC(C)[Sn].
What is the InChIKey of CID 173288501?
The InChIKey is NQKGKWUZUCZSDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N.2BrH.Sn/c1-4-6-8(3)7-9-5-2;;;/h4,8-9H,5-7H2,1-3H3;2*1H;.
What are the key properties of CID 173288501?
CID 173288501 has a molecular weight of 408.77 g/mol, XLogP of 2.75, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173288501 is sourced from PubChem (CID 173288501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).