C16H6N6 — CID 173302633
4-phenyl-2H-pyridine-1,2,3,5,6-pentacarbonitrile (PubChem CID 173302633) has the molecular formula C16H6N6 and a molecular weight of 282.27 g/mol. Its IUPAC name is 4-phenyl-2H-pyridine-1,2,3,5,6-pentacarbonitrile.
| Compound Name | 4-phenyl-2H-pyridine-1,2,3,5,6-pentacarbonitrile |
|---|---|
| PubChem CID | 173302633 |
| Molecular Formula | C16H6N6 |
| Molecular Weight | 282.27 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 4-phenyl-2H-pyridine-1,2,3,5,6-pentacarbonitrile |
| SMILES | N#CC1=C(C#N)N(C#N)C(C#N)C(C#N)=C1c1ccccc1 |
| InChI | InChI=1S/C16H6N6/c17-6-12-14(8-19)22(10-21)15(9-20)13(7-18)16(12)11-4-2-1-3-5-11/h1-5,14H |
| InChIKey | ZCZDNBFKULGNBV-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 122.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.27 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|