C35H19N5 — CID 101373867
8,10,10-triphenyl-11,16-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),2,4,6,8,11,13-heptaene-13,14,15-tricarbonitrile (PubChem CID 101373867) has the molecular formula C35H19N5 and a molecular weight of 509.57 g/mol. Its IUPAC name is 8,10,10-triphenyl-11,16-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),2,4,6,8,11,13-heptaene-13,14,15-tricarbonitrile.
| Compound Name | 8,10,10-triphenyl-11,16-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),2,4,6,8,11,13-heptaene-13,14,15-tricarbonitrile |
|---|---|
| PubChem CID | 101373867 |
| Molecular Formula | C35H19N5 |
| Molecular Weight | 509.57 g/mol |
| Exact Mass | 509.16 |
| IUPAC Name | 8,10,10-triphenyl-11,16-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),2,4,6,8,11,13-heptaene-13,14,15-tricarbonitrile |
| SMILES | N#CC1=C(C#N)C(C#N)=C2c3ccccc3C(c3ccccc3)=C3N2C1=NC3(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H19N5/c36-20-28-29(21-37)32-27-19-11-10-18-26(27)31(23-12-4-1-5-13-23)33-35(24-14-6-2-7-15-24,25-16-8-3-9-17-25)39-34(40(32)33)30(28)22-38/h1-19H |
| InChIKey | MCNCZNUBRFBJTM-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 86.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.57 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |