C26H29F5O — CID 173305887
2-[4-(4-ethylcyclohexyl)cyclohexyl]-1,3-difluoro-4-(3,4,5-trifluorophenoxy)benzene (PubChem CID 173305887) has the molecular formula C26H29F5O and a molecular weight of 452.51 g/mol. Its IUPAC name is 2-[4-(4-ethylcyclohexyl)cyclohexyl]-1,3-difluoro-4-(3,4,5-trifluorophenoxy)benzene.
| Compound Name | 2-[4-(4-ethylcyclohexyl)cyclohexyl]-1,3-difluoro-4-(3,4,5-trifluorophenoxy)benzene |
|---|---|
| PubChem CID | 173305887 |
| Molecular Formula | C26H29F5O |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | 2-[4-(4-ethylcyclohexyl)cyclohexyl]-1,3-difluoro-4-(3,4,5-trifluorophenoxy)benzene |
| SMILES | CCC1CCC(C2CCC(c3c(F)ccc(Oc4cc(F)c(F)c(F)c4)c3F)CC2)CC1 |
| InChI | InChI=1S/C26H29F5O/c1-2-15-3-5-16(6-4-15)17-7-9-18(10-8-17)24-20(27)11-12-23(26(24)31)32-19-13-21(28)25(30)22(29)14-19/h11-18H,2-10H2,1H3 |
| InChIKey | JNLVSANEJUXEAR-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|