About 2-methyloct-1-ene-1,3-diol
2-methyloct-1-ene-1,3-diol (PubChem CID 173308753) has the molecular formula C9H18O2
and a molecular weight of 158.24 g/mol. Its IUPAC name is 2-methyloct-1-ene-1,3-diol.
Molecular Properties
| Compound Name | 2-methyloct-1-ene-1,3-diol |
| PubChem CID | 173308753 |
| Molecular Formula | C9H18O2 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.13 |
| IUPAC Name | 2-methyloct-1-ene-1,3-diol |
| SMILES | CCCCCC(O)C(C)=CO |
| InChI | InChI=1S/C9H18O2/c1-3-4-5-6-9(11)8(2)7-10/h7,9-11H,3-6H2,1-2H3 |
| InChIKey | NKOHXIXOOQXTIA-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methyloct-1-ene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyloct-1-ene-1,3-diol?
The IUPAC name of 2-methyloct-1-ene-1,3-diol (CID 173308753) is 2-methyloct-1-ene-1,3-diol.
What is the SMILES notation for 2-methyloct-1-ene-1,3-diol?
The canonical SMILES for 2-methyloct-1-ene-1,3-diol is CCCCCC(O)C(C)=CO.
What is the InChIKey of 2-methyloct-1-ene-1,3-diol?
The InChIKey is NKOHXIXOOQXTIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O2/c1-3-4-5-6-9(11)8(2)7-10/h7,9-11H,3-6H2,1-2H3.
What are the key properties of 2-methyloct-1-ene-1,3-diol?
2-methyloct-1-ene-1,3-diol has a molecular weight of 158.24 g/mol, XLogP of 2.39, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyloct-1-ene-1,3-diol is sourced from PubChem (CID 173308753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).