C16H32O4 — CID 5385867
(Z)-6-methoxy-8-methyltetradec-7-ene-2,5,9-triol (PubChem CID 5385867) has the molecular formula C16H32O4 and a molecular weight of 288.43 g/mol. Its IUPAC name is (Z)-6-methoxy-8-methyltetradec-7-ene-2,5,9-triol.
| Compound Name | (Z)-6-methoxy-8-methyltetradec-7-ene-2,5,9-triol |
|---|---|
| PubChem CID | 5385867 |
| Molecular Formula | C16H32O4 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.23 |
| IUPAC Name | (Z)-6-methoxy-8-methyltetradec-7-ene-2,5,9-triol |
| SMILES | CCCCCC(O)/C(C)=C\C(OC)C(O)CCC(C)O |
| InChI | InChI=1S/C16H32O4/c1-5-6-7-8-14(18)12(2)11-16(20-4)15(19)10-9-13(3)17/h11,13-19H,5-10H2,1-4H3/b12-11- |
| InChIKey | PAHCSKQOVSLRGB-QXMHVHEDSA-N |
| XLogP | 2.41 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|