C10H14O2 — CID 173309015
3-ethenylocta-1,4,6-triene-1,8-diol (PubChem CID 173309015) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is 3-ethenylocta-1,4,6-triene-1,8-diol.
| Compound Name | 3-ethenylocta-1,4,6-triene-1,8-diol |
|---|---|
| PubChem CID | 173309015 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | 3-ethenylocta-1,4,6-triene-1,8-diol |
| SMILES | C=CC(C=CO)C=CC=CCO |
| InChI | InChI=1S/C10H14O2/c1-2-10(7-9-12)6-4-3-5-8-11/h2-7,9-12H,1,8H2 |
| InChIKey | QVPKFYZHRXJOBS-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|