C27H34I2N4 — CID 173312660
3-(2,7-diamino-9-phenylphenanthridin-10-yl)propyl-diethyl-methylazanium;iodide;hydroiodide (PubChem CID 173312660) has the molecular formula C27H34I2N4 and a molecular weight of 668.41 g/mol. Its IUPAC name is 3-(2,7-diamino-9-phenylphenanthridin-10-yl)propyl-diethyl-methylazanium;iodide;hydroiodide.
| Compound Name | 3-(2,7-diamino-9-phenylphenanthridin-10-yl)propyl-diethyl-methylazanium;iodide;hydroiodide |
|---|---|
| PubChem CID | 173312660 |
| Molecular Formula | C27H34I2N4 |
| Molecular Weight | 668.41 g/mol |
| Exact Mass | 668.09 |
| IUPAC Name | 3-(2,7-diamino-9-phenylphenanthridin-10-yl)propyl-diethyl-methylazanium;iodide;hydroiodide |
| SMILES | CC[N+](C)(CC)CCCc1c(-c2ccccc2)cc(N)c2cnc3ccc(N)cc3c12.I.[I-] |
| InChI | InChI=1S/C27H33N4.2HI/c1-4-31(3,5-2)15-9-12-21-22(19-10-7-6-8-11-19)17-25(29)24-18-30-26-14-13-20(28)16-23(26)27(21)24;;/h6-8,10-11,13-14,16-18H,4-5,9,12,15,28-29H2,1-3H3;2*1H/q+1;;/p-1 |
| InChIKey | GNEOYHKNOZPNTD-UHFFFAOYSA-M |
| XLogP | 3.26 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.41 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|