About 5-nitropentan-2-one;triphenylphosphane;hydrobromide
5-nitropentan-2-one;triphenylphosphane;hydrobromide (PubChem CID 173323779) has the molecular formula C23H25BrNO3P
and a molecular weight of 474.34 g/mol. Its IUPAC name is 5-nitropentan-2-one;triphenylphosphane;hydrobromide.
Molecular Properties
| Compound Name | 5-nitropentan-2-one;triphenylphosphane;hydrobromide |
| PubChem CID | 173323779 |
| Molecular Formula | C23H25BrNO3P |
| Molecular Weight | 474.34 g/mol |
| Exact Mass | 473.08 |
| IUPAC Name | 5-nitropentan-2-one;triphenylphosphane;hydrobromide |
| SMILES | Br.CC(=O)CCC[N+](=O)[O-].c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.C5H9NO3.BrH/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-5(7)3-2-4-6(8)9;/h1-15H;2-4H2,1H3;1H |
| InChIKey | HNBSRFNIRTUFTB-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 474.34 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 5-nitropentan-2-one;triphenylphosphane;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-nitropentan-2-one;triphenylphosphane;hydrobromide?
The IUPAC name of 5-nitropentan-2-one;triphenylphosphane;hydrobromide (CID 173323779) is 5-nitropentan-2-one;triphenylphosphane;hydrobromide.
What is the SMILES notation for 5-nitropentan-2-one;triphenylphosphane;hydrobromide?
The canonical SMILES for 5-nitropentan-2-one;triphenylphosphane;hydrobromide is Br.CC(=O)CCC[N+](=O)[O-].c1ccc(P(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 5-nitropentan-2-one;triphenylphosphane;hydrobromide?
The InChIKey is HNBSRFNIRTUFTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15P.C5H9NO3.BrH/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-5(7)3-2-4-6(8)9;/h1-15H;2-4H2,1H3;1H.
What are the key properties of 5-nitropentan-2-one;triphenylphosphane;hydrobromide?
5-nitropentan-2-one;triphenylphosphane;hydrobromide has a molecular weight of 474.34 g/mol, XLogP of 4.66, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-nitropentan-2-one;triphenylphosphane;hydrobromide is sourced from PubChem (CID 173323779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).