C17H16O — CID 173328532
1-phenylmethoxy-1,4-dihydronaphthalene (PubChem CID 173328532) has the molecular formula C17H16O and a molecular weight of 236.31 g/mol. Its IUPAC name is 1-phenylmethoxy-1,4-dihydronaphthalene.
| Compound Name | 1-phenylmethoxy-1,4-dihydronaphthalene |
|---|---|
| PubChem CID | 173328532 |
| Molecular Formula | C17H16O |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 1-phenylmethoxy-1,4-dihydronaphthalene |
| SMILES | C1=CC(OCc2ccccc2)c2ccccc2C1 |
| InChI | InChI=1S/C17H16O/c1-2-7-14(8-3-1)13-18-17-12-6-10-15-9-4-5-11-16(15)17/h1-9,11-12,17H,10,13H2 |
| InChIKey | CBCWZOAPWWYWLF-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|