C21H46NO7P — CID 173331971
[3-carboxy-2-[hydroxy-[8-(3-methylpentoxy)octoxy]phosphanyl]oxypropyl]-trimethylazanium hydroxide (PubChem CID 173331971) has the molecular formula C21H46NO7P and a molecular weight of 455.57 g/mol. Its IUPAC name is [3-carboxy-2-[hydroxy-[8-(3-methylpentoxy)octoxy]phosphanyl]oxypropyl]-trimethylazanium hydroxide.
| Compound Name | [3-carboxy-2-[hydroxy-[8-(3-methylpentoxy)octoxy]phosphanyl]oxypropyl]-trimethylazanium hydroxide |
|---|---|
| PubChem CID | 173331971 |
| Molecular Formula | C21H46NO7P |
| Molecular Weight | 455.57 g/mol |
| Exact Mass | 455.30 |
| IUPAC Name | [3-carboxy-2-[hydroxy-[8-(3-methylpentoxy)octoxy]phosphanyl]oxypropyl]-trimethylazanium hydroxide |
| SMILES | CCC(C)CCOCCCCCCCCO[P@](O)OC(CC(=O)O)C[N+](C)(C)C.[OH-] |
| InChI | InChI=1S/C21H44NO6P.H2O/c1-6-19(2)13-16-26-14-11-9-7-8-10-12-15-27-29(25)28-20(17-21(23)24)18-22(3,4)5;/h19-20,25H,6-18H2,1-5H3;1H2/t19?,20?,29-;/m0./s1 |
| InChIKey | YKWIRIDZQZIVTQ-ZRQOURKHSA-N |
| XLogP | 4.40 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.57 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|