C22H48NO7P — CID 173332032
[3-carboxy-2-[5-decan-3-yloxypentoxy(hydroxy)phosphanyl]oxypropyl]-trimethylazanium hydroxide (PubChem CID 173332032) has the molecular formula C22H48NO7P and a molecular weight of 469.60 g/mol. Its IUPAC name is [3-carboxy-2-[5-decan-3-yloxypentoxy(hydroxy)phosphanyl]oxypropyl]-trimethylazanium hydroxide.
| Compound Name | [3-carboxy-2-[5-decan-3-yloxypentoxy(hydroxy)phosphanyl]oxypropyl]-trimethylazanium hydroxide |
|---|---|
| PubChem CID | 173332032 |
| Molecular Formula | C22H48NO7P |
| Molecular Weight | 469.60 g/mol |
| Exact Mass | 469.32 |
| IUPAC Name | [3-carboxy-2-[5-decan-3-yloxypentoxy(hydroxy)phosphanyl]oxypropyl]-trimethylazanium hydroxide |
| SMILES | CCCCCCCC(CC)OCCCCCO[P@](O)OC(CC(=O)O)C[N+](C)(C)C.[OH-] |
| InChI | InChI=1S/C22H46NO6P.H2O/c1-6-8-9-10-12-15-20(7-2)27-16-13-11-14-17-28-30(26)29-21(18-22(24)25)19-23(3,4)5;/h20-21,26H,6-19H2,1-5H3;1H2/t20?,21?,30-;/m0./s1 |
| InChIKey | VLKGNAIMESTACM-HGQVPEBFSA-N |
| XLogP | 4.94 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.60 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|