C21H45NO6P+ — CID 57136936
[3-carboxy-2-[hydroxy(6-octan-2-yloxyhexoxy)phosphanyl]oxypropyl]-trimethylazanium (PubChem CID 57136936) has the molecular formula C21H45NO6P+ and a molecular weight of 438.57 g/mol. Its IUPAC name is [3-carboxy-2-[hydroxy(6-octan-2-yloxyhexoxy)phosphanyl]oxypropyl]-trimethylazanium.
| Compound Name | [3-carboxy-2-[hydroxy(6-octan-2-yloxyhexoxy)phosphanyl]oxypropyl]-trimethylazanium |
|---|---|
| PubChem CID | 57136936 |
| Molecular Formula | C21H45NO6P+ |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.30 |
| IUPAC Name | [3-carboxy-2-[hydroxy(6-octan-2-yloxyhexoxy)phosphanyl]oxypropyl]-trimethylazanium |
| SMILES | CCCCCCC(C)OCCCCCCO[P@@](O)OC(CC(=O)O)C[N+](C)(C)C |
| InChI | InChI=1S/C21H44NO6P/c1-6-7-8-11-14-19(2)26-15-12-9-10-13-16-27-29(25)28-20(17-21(23)24)18-22(3,4)5/h19-20,25H,6-18H2,1-5H3/p+1/t19?,20?,29-/m1/s1 |
| InChIKey | JXCJYUYCNOQYSB-XPWNFQNOSA-O |
| XLogP | 4.72 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|